C25H29N3O3S — CID 23827061
ethyl 4-[2-[1-[(4-methylphenyl)methyl]indol-3-yl]sulfanylacetyl]piperazine-1-carboxylate (PubChem CID 23827061) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is ethyl 4-[2-[1-[(4-methylphenyl)methyl]indol-3-yl]sulfanylacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[1-[(4-methylphenyl)methyl]indol-3-yl]sulfanylacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 23827061 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | ethyl 4-[2-[1-[(4-methylphenyl)methyl]indol-3-yl]sulfanylacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CSc2cn(Cc3ccc(C)cc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C25H29N3O3S/c1-3-31-25(30)27-14-12-26(13-15-27)24(29)18-32-23-17-28(22-7-5-4-6-21(22)23)16-20-10-8-19(2)9-11-20/h4-11,17H,3,12-16,18H2,1-2H3 |
| InChIKey | NTTPOTMPTNWANV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |