C25H24N2OS — CID 3621175
2-(1-benzylindol-3-yl)sulfanyl-N-(4-ethylphenyl)acetamide (PubChem CID 3621175) has the molecular formula C25H24N2OS and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-(1-benzylindol-3-yl)sulfanyl-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-(1-benzylindol-3-yl)sulfanyl-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 3621175 |
| Molecular Formula | C25H24N2OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-(1-benzylindol-3-yl)sulfanyl-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CSc2cn(Cc3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H24N2OS/c1-2-19-12-14-21(15-13-19)26-25(28)18-29-24-17-27(16-20-8-4-3-5-9-20)23-11-7-6-10-22(23)24/h3-15,17H,2,16,18H2,1H3,(H,26,28) |
| InChIKey | NAAAOZFUTKBGAP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |