C23H18BrFN2OS — CID 4608403
N-(4-bromophenyl)-2-[1-[(3-fluorophenyl)methyl]indol-3-yl]sulfanylacetamide (PubChem CID 4608403) has the molecular formula C23H18BrFN2OS and a molecular weight of 469.38 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[1-[(3-fluorophenyl)methyl]indol-3-yl]sulfanylacetamide.
| Compound Name | N-(4-bromophenyl)-2-[1-[(3-fluorophenyl)methyl]indol-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4608403 |
| Molecular Formula | C23H18BrFN2OS |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | N-(4-bromophenyl)-2-[1-[(3-fluorophenyl)methyl]indol-3-yl]sulfanylacetamide |
| SMILES | O=C(CSc1cn(Cc2cccc(F)c2)c2ccccc12)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H18BrFN2OS/c24-17-8-10-19(11-9-17)26-23(28)15-29-22-14-27(21-7-2-1-6-20(21)22)13-16-4-3-5-18(25)12-16/h1-12,14H,13,15H2,(H,26,28) |
| InChIKey | AIGURQPEHHBFIO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |