C25H24N2OS — CID 4294472
2-(1-benzylindol-3-yl)sulfanyl-N-(3,5-dimethylphenyl)acetamide (PubChem CID 4294472) has the molecular formula C25H24N2OS and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-(1-benzylindol-3-yl)sulfanyl-N-(3,5-dimethylphenyl)acetamide.
| Compound Name | 2-(1-benzylindol-3-yl)sulfanyl-N-(3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 4294472 |
| Molecular Formula | C25H24N2OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-(1-benzylindol-3-yl)sulfanyl-N-(3,5-dimethylphenyl)acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)CSc2cn(Cc3ccccc3)c3ccccc23)c1 |
| InChI | InChI=1S/C25H24N2OS/c1-18-12-19(2)14-21(13-18)26-25(28)17-29-24-16-27(15-20-8-4-3-5-9-20)23-11-7-6-10-22(23)24/h3-14,16H,15,17H2,1-2H3,(H,26,28) |
| InChIKey | JPXNZBYUEQAAGO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |