C23H18BrClN2OS — CID 4581043
2-[1-[(4-bromophenyl)methyl]indol-3-yl]sulfanyl-N-(3-chlorophenyl)acetamide (PubChem CID 4581043) has the molecular formula C23H18BrClN2OS and a molecular weight of 485.83 g/mol. Its IUPAC name is 2-[1-[(4-bromophenyl)methyl]indol-3-yl]sulfanyl-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[1-[(4-bromophenyl)methyl]indol-3-yl]sulfanyl-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 4581043 |
| Molecular Formula | C23H18BrClN2OS |
| Molecular Weight | 485.83 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | 2-[1-[(4-bromophenyl)methyl]indol-3-yl]sulfanyl-N-(3-chlorophenyl)acetamide |
| SMILES | O=C(CSc1cn(Cc2ccc(Br)cc2)c2ccccc12)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H18BrClN2OS/c24-17-10-8-16(9-11-17)13-27-14-22(20-6-1-2-7-21(20)27)29-15-23(28)26-19-5-3-4-18(25)12-19/h1-12,14H,13,15H2,(H,26,28) |
| InChIKey | CGLQQBUOBLEHPX-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.83 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |