C26H24ClN3O2S — CID 3275644
N-[2-[3-[2-(3-chloroanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]-4-methylbenzamide (PubChem CID 3275644) has the molecular formula C26H24ClN3O2S and a molecular weight of 478.02 g/mol. Its IUPAC name is N-[2-[3-[2-(3-chloroanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[3-[2-(3-chloroanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3275644 |
| Molecular Formula | C26H24ClN3O2S |
| Molecular Weight | 478.02 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N-[2-[3-[2-(3-chloroanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCn2cc(SCC(=O)Nc3cccc(Cl)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H24ClN3O2S/c1-18-9-11-19(12-10-18)26(32)28-13-14-30-16-24(22-7-2-3-8-23(22)30)33-17-25(31)29-21-6-4-5-20(27)15-21/h2-12,15-16H,13-14,17H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | MPYVEADTLCIBEE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.02 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |