C27H27N3O3S — CID 4118800
N-[2-[3-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]-4-methylbenzamide (PubChem CID 4118800) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[2-[3-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[3-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 4118800 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[2-[3-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]-4-methylbenzamide |
| SMILES | COc1cccc(NC(=O)CSc2cn(CCNC(=O)c3ccc(C)cc3)c3ccccc23)c1 |
| InChI | InChI=1S/C27H27N3O3S/c1-19-10-12-20(13-11-19)27(32)28-14-15-30-17-25(23-8-3-4-9-24(23)30)34-18-26(31)29-21-6-5-7-22(16-21)33-2/h3-13,16-17H,14-15,18H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | QYJPJLTXRJKFFH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |