C26H24FN3O3S — CID 4301484
N-[2-[3-[2-(3-fluoroanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]-2-methoxybenzamide (PubChem CID 4301484) has the molecular formula C26H24FN3O3S and a molecular weight of 477.56 g/mol. Its IUPAC name is N-[2-[3-[2-(3-fluoroanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]-2-methoxybenzamide.
| Compound Name | N-[2-[3-[2-(3-fluoroanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 4301484 |
| Molecular Formula | C26H24FN3O3S |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-[2-[3-[2-(3-fluoroanilino)-2-oxoethyl]sulfanylindol-1-yl]ethyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCCn1cc(SCC(=O)Nc2cccc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C26H24FN3O3S/c1-33-23-12-5-3-10-21(23)26(32)28-13-14-30-16-24(20-9-2-4-11-22(20)30)34-17-25(31)29-19-8-6-7-18(27)15-19/h2-12,15-16H,13-14,17H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | QHWSQTAJCLEXCK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |