C23H25FN2OS — CID 23794200
2-[1-[(3-fluorophenyl)methyl]indol-3-yl]sulfanyl-1-(4-methylpiperidin-1-yl)ethanone (PubChem CID 23794200) has the molecular formula C23H25FN2OS and a molecular weight of 396.53 g/mol. Its IUPAC name is 2-[1-[(3-fluorophenyl)methyl]indol-3-yl]sulfanyl-1-(4-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-[1-[(3-fluorophenyl)methyl]indol-3-yl]sulfanyl-1-(4-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 23794200 |
| Molecular Formula | C23H25FN2OS |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-[1-[(3-fluorophenyl)methyl]indol-3-yl]sulfanyl-1-(4-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCN(C(=O)CSc2cn(Cc3cccc(F)c3)c3ccccc23)CC1 |
| InChI | InChI=1S/C23H25FN2OS/c1-17-9-11-25(12-10-17)23(27)16-28-22-15-26(21-8-3-2-7-20(21)22)14-18-5-4-6-19(24)13-18/h2-8,13,15,17H,9-12,14,16H2,1H3 |
| InChIKey | NSKNAAKOJRRPQK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |