C24H27FN2OS — CID 4176600
1-(2-ethylpiperidin-1-yl)-2-[1-[(3-fluorophenyl)methyl]indol-3-yl]sulfanylethanone (PubChem CID 4176600) has the molecular formula C24H27FN2OS and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-(2-ethylpiperidin-1-yl)-2-[1-[(3-fluorophenyl)methyl]indol-3-yl]sulfanylethanone.
| Compound Name | 1-(2-ethylpiperidin-1-yl)-2-[1-[(3-fluorophenyl)methyl]indol-3-yl]sulfanylethanone |
|---|---|
| PubChem CID | 4176600 |
| Molecular Formula | C24H27FN2OS |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-(2-ethylpiperidin-1-yl)-2-[1-[(3-fluorophenyl)methyl]indol-3-yl]sulfanylethanone |
| SMILES | CCC1CCCCN1C(=O)CSc1cn(Cc2cccc(F)c2)c2ccccc12 |
| InChI | InChI=1S/C24H27FN2OS/c1-2-20-10-5-6-13-27(20)24(28)17-29-23-16-26(22-12-4-3-11-21(22)23)15-18-8-7-9-19(25)14-18/h3-4,7-9,11-12,14,16,20H,2,5-6,10,13,15,17H2,1H3 |
| InChIKey | NZXVUJVVBUNHPC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |