C23H24FN3OS — CID 7296351
1-[(2S)-2-ethylpiperidin-1-yl]-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylethanone (PubChem CID 7296351) has the molecular formula C23H24FN3OS and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[(2S)-2-ethylpiperidin-1-yl]-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylethanone.
| Compound Name | 1-[(2S)-2-ethylpiperidin-1-yl]-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylethanone |
|---|---|
| PubChem CID | 7296351 |
| Molecular Formula | C23H24FN3OS |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 1-[(2S)-2-ethylpiperidin-1-yl]-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylethanone |
| SMILES | CC[C@H]1CCCCN1C(=O)CSc1nnc(-c2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C23H24FN3OS/c1-2-18-7-5-6-14-27(18)21(28)15-29-23-20-9-4-3-8-19(20)22(25-26-23)16-10-12-17(24)13-11-16/h3-4,8-13,18H,2,5-7,14-15H2,1H3/t18-/m0/s1 |
| InChIKey | IKTCIDPPCDIAJK-SFHVURJKSA-N |
| XLogP | 5.32 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |