C23H25N3OS — CID 7915631
1-[(2R)-2-ethylpiperidin-1-yl]-2-(4-phenylphthalazin-1-yl)sulfanylethanone (PubChem CID 7915631) has the molecular formula C23H25N3OS and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-[(2R)-2-ethylpiperidin-1-yl]-2-(4-phenylphthalazin-1-yl)sulfanylethanone.
| Compound Name | 1-[(2R)-2-ethylpiperidin-1-yl]-2-(4-phenylphthalazin-1-yl)sulfanylethanone |
|---|---|
| PubChem CID | 7915631 |
| Molecular Formula | C23H25N3OS |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-[(2R)-2-ethylpiperidin-1-yl]-2-(4-phenylphthalazin-1-yl)sulfanylethanone |
| SMILES | CC[C@@H]1CCCCN1C(=O)CSc1nnc(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C23H25N3OS/c1-2-18-12-8-9-15-26(18)21(27)16-28-23-20-14-7-6-13-19(20)22(24-25-23)17-10-4-3-5-11-17/h3-7,10-11,13-14,18H,2,8-9,12,15-16H2,1H3/t18-/m1/s1 |
| InChIKey | INGILDLGIMDILB-GOSISDBHSA-N |
| XLogP | 5.18 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |