C22H22FN3OS — CID 7296297
2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanyl-1-[(2S)-2-methylpiperidin-1-yl]ethanone (PubChem CID 7296297) has the molecular formula C22H22FN3OS and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanyl-1-[(2S)-2-methylpiperidin-1-yl]ethanone.
| Compound Name | 2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanyl-1-[(2S)-2-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 7296297 |
| Molecular Formula | C22H22FN3OS |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanyl-1-[(2S)-2-methylpiperidin-1-yl]ethanone |
| SMILES | C[C@H]1CCCCN1C(=O)CSc1nnc(-c2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C22H22FN3OS/c1-15-6-4-5-13-26(15)20(27)14-28-22-19-8-3-2-7-18(19)21(24-25-22)16-9-11-17(23)12-10-16/h2-3,7-12,15H,4-6,13-14H2,1H3/t15-/m0/s1 |
| InChIKey | UWUHAWTXBWUHOE-HNNXBMFYSA-N |
| XLogP | 4.93 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |