C24H21N3OS2 — CID 43027830
2-(4-phenylphthalazin-1-yl)sulfanyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone (PubChem CID 43027830) has the molecular formula C24H21N3OS2 and a molecular weight of 431.59 g/mol. Its IUPAC name is 2-(4-phenylphthalazin-1-yl)sulfanyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-(4-phenylphthalazin-1-yl)sulfanyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 43027830 |
| Molecular Formula | C24H21N3OS2 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-(4-phenylphthalazin-1-yl)sulfanyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
| SMILES | O=C(CSc1nnc(-c2ccccc2)c2ccccc12)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C24H21N3OS2/c28-22(27-14-6-12-20(27)21-13-7-15-29-21)16-30-24-19-11-5-4-10-18(19)23(25-26-24)17-8-2-1-3-9-17/h1-5,7-11,13,15,20H,6,12,14,16H2 |
| InChIKey | VHBTVCXSGHCSHA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |