C19H18N2OS2 — CID 40791024
2-quinolin-2-ylsulfanyl-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone (PubChem CID 40791024) has the molecular formula C19H18N2OS2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 2-quinolin-2-ylsulfanyl-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone.
| Compound Name | 2-quinolin-2-ylsulfanyl-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 40791024 |
| Molecular Formula | C19H18N2OS2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-quinolin-2-ylsulfanyl-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone |
| SMILES | O=C(CSc1ccc2ccccc2n1)N1CCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C19H18N2OS2/c22-19(21-11-3-7-16(21)17-8-4-12-23-17)13-24-18-10-9-14-5-1-2-6-15(14)20-18/h1-2,4-6,8-10,12,16H,3,7,11,13H2/t16-/m0/s1 |
| InChIKey | QVFDBMWINZLKCT-INIZCTEOSA-N |
| XLogP | 4.75 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |