C14H19NO3S2 — CID 64914478
2-methyl-3-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]sulfanylpropanoic acid (PubChem CID 64914478) has the molecular formula C14H19NO3S2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 2-methyl-3-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]sulfanylpropanoic acid.
| Compound Name | 2-methyl-3-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 64914478 |
| Molecular Formula | C14H19NO3S2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-methyl-3-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]sulfanylpropanoic acid |
| SMILES | CC(CSCC(=O)N1CCCC1c1cccs1)C(=O)O |
| InChI | InChI=1S/C14H19NO3S2/c1-10(14(17)18)8-19-9-13(16)15-6-2-4-11(15)12-5-3-7-20-12/h3,5,7,10-11H,2,4,6,8-9H2,1H3,(H,17,18) |
| InChIKey | DJXMGTVTAFIHDH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |