C18H21NO2S2 — CID 86978365
2-(2-phenoxyethylsulfanyl)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone (PubChem CID 86978365) has the molecular formula C18H21NO2S2 and a molecular weight of 347.51 g/mol. Its IUPAC name is 2-(2-phenoxyethylsulfanyl)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-(2-phenoxyethylsulfanyl)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 86978365 |
| Molecular Formula | C18H21NO2S2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-(2-phenoxyethylsulfanyl)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
| SMILES | O=C(CSCCOc1ccccc1)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C18H21NO2S2/c20-18(14-22-13-11-21-15-6-2-1-3-7-15)19-10-4-8-16(19)17-9-5-12-23-17/h1-3,5-7,9,12,16H,4,8,10-11,13-14H2 |
| InChIKey | IICNPDXQZBISNF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|