C13H18N2O3S2 — CID 61142277
(2R)-2-amino-3-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]sulfanylpropanoic acid (PubChem CID 61142277) has the molecular formula C13H18N2O3S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 61142277 |
| Molecular Formula | C13H18N2O3S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (2R)-2-amino-3-[2-oxo-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethyl]sulfanylpropanoic acid |
| SMILES | N[C@@H](CSCC(=O)N1CCCC1c1cccs1)C(=O)O |
| InChI | InChI=1S/C13H18N2O3S2/c14-9(13(17)18)7-19-8-12(16)15-5-1-3-10(15)11-4-2-6-20-11/h2,4,6,9-10H,1,3,5,7-8,14H2,(H,17,18)/t9-,10?/m0/s1 |
| InChIKey | IETAPJCGNLGNAE-RGURZIINSA-N |
| XLogP | 1.56 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |