C21H21NO2S — CID 41103665
3-(5-phenylfuran-2-yl)-1-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propan-1-one (PubChem CID 41103665) has the molecular formula C21H21NO2S and a molecular weight of 351.47 g/mol. Its IUPAC name is 3-(5-phenylfuran-2-yl)-1-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-(5-phenylfuran-2-yl)-1-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 41103665 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-(5-phenylfuran-2-yl)-1-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propan-1-one |
| SMILES | O=C(CCc1ccc(-c2ccccc2)o1)N1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C21H21NO2S/c23-21(22-14-4-8-18(22)20-9-5-15-25-20)13-11-17-10-12-19(24-17)16-6-2-1-3-7-16/h1-3,5-7,9-10,12,15,18H,4,8,11,13-14H2/t18-/m1/s1 |
| InChIKey | XCXXYGFGLHFPKO-GOSISDBHSA-N |
| XLogP | 5.30 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |