C20H22N4OS2 — CID 46639860
2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone (PubChem CID 46639860) has the molecular formula C20H22N4OS2 and a molecular weight of 398.56 g/mol. Its IUPAC name is 2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 46639860 |
| Molecular Formula | C20H22N4OS2 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
| SMILES | CCNc1nc(SCC(=O)N2CCCC2c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C20H22N4OS2/c1-2-21-19-14-7-3-4-8-15(14)22-20(23-19)27-13-18(25)24-11-5-9-16(24)17-10-6-12-26-17/h3-4,6-8,10,12,16H,2,5,9,11,13H2,1H3,(H,21,22,23) |
| InChIKey | ZRDDTLZPAGWQGT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |