C20H26N4OS — CID 25488988
1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(methylamino)quinazolin-2-yl]sulfanylethanone (PubChem CID 25488988) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(methylamino)quinazolin-2-yl]sulfanylethanone.
| Compound Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(methylamino)quinazolin-2-yl]sulfanylethanone |
|---|---|
| PubChem CID | 25488988 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(methylamino)quinazolin-2-yl]sulfanylethanone |
| SMILES | CNc1nc(SCC(=O)N2CCC[C@H]3CCCC[C@H]32)nc2ccccc12 |
| InChI | InChI=1S/C20H26N4OS/c1-21-19-15-9-3-4-10-16(15)22-20(23-19)26-13-18(25)24-12-6-8-14-7-2-5-11-17(14)24/h3-4,9-10,14,17H,2,5-8,11-13H2,1H3,(H,21,22,23)/t14-,17-/m1/s1 |
| InChIKey | OKOIKNASJQEYFS-RHSMWYFYSA-N |
| XLogP | 3.94 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |