C22H29N3O2S — CID 84840131
2-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-3-propan-2-ylquinazolin-4-one (PubChem CID 84840131) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 2-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-3-propan-2-ylquinazolin-4-one.
| Compound Name | 2-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-3-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 84840131 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-3-propan-2-ylquinazolin-4-one |
| SMILES | CC(C)n1c(SCC(=O)N2CCCC3CCCCC32)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H29N3O2S/c1-15(2)25-21(27)17-10-4-5-11-18(17)23-22(25)28-14-20(26)24-13-7-9-16-8-3-6-12-19(16)24/h4-5,10-11,15-16,19H,3,6-9,12-14H2,1-2H3 |
| InChIKey | LKYUFKTVJIXTFA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |