C23H31N3O2S — CID 11933611
2-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]sulfanyl-3-[(2S)-butan-2-yl]quinazolin-4-one (PubChem CID 11933611) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is 2-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]sulfanyl-3-[(2S)-butan-2-yl]quinazolin-4-one.
| Compound Name | 2-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]sulfanyl-3-[(2S)-butan-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 11933611 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 2-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]sulfanyl-3-[(2S)-butan-2-yl]quinazolin-4-one |
| SMILES | CC[C@H](C)n1c(SCC(=O)N2CC[C@@H]3CCCC[C@@H]3C2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H31N3O2S/c1-3-16(2)26-22(28)19-10-6-7-11-20(19)24-23(26)29-15-21(27)25-13-12-17-8-4-5-9-18(17)14-25/h6-7,10-11,16-18H,3-5,8-9,12-15H2,1-2H3/t16-,17-,18+/m0/s1 |
| InChIKey | BRVCSNUWPZICJK-OKZBNKHCSA-N |
| XLogP | 4.50 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |