C16H16N2O3S2 — CID 51152877
2-(4-nitrophenyl)sulfanyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone (PubChem CID 51152877) has the molecular formula C16H16N2O3S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-(4-nitrophenyl)sulfanyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-(4-nitrophenyl)sulfanyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 51152877 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-(4-nitrophenyl)sulfanyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
| SMILES | O=C(CSc1ccc([N+](=O)[O-])cc1)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C16H16N2O3S2/c19-16(11-23-13-7-5-12(6-8-13)18(20)21)17-9-1-3-14(17)15-4-2-10-22-15/h2,4-8,10,14H,1,3,9,11H2 |
| InChIKey | OIDBZMDYMJXVOD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|