C22H23FN2OS — CID 4548690
2-[1-[(4-fluorophenyl)methyl]indol-3-yl]sulfanyl-1-piperidin-1-ylethanone (PubChem CID 4548690) has the molecular formula C22H23FN2OS and a molecular weight of 382.50 g/mol. Its IUPAC name is 2-[1-[(4-fluorophenyl)methyl]indol-3-yl]sulfanyl-1-piperidin-1-ylethanone.
| Compound Name | 2-[1-[(4-fluorophenyl)methyl]indol-3-yl]sulfanyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 4548690 |
| Molecular Formula | C22H23FN2OS |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-[1-[(4-fluorophenyl)methyl]indol-3-yl]sulfanyl-1-piperidin-1-ylethanone |
| SMILES | O=C(CSc1cn(Cc2ccc(F)cc2)c2ccccc12)N1CCCCC1 |
| InChI | InChI=1S/C22H23FN2OS/c23-18-10-8-17(9-11-18)14-25-15-21(19-6-2-3-7-20(19)25)27-16-22(26)24-12-4-1-5-13-24/h2-3,6-11,15H,1,4-5,12-14,16H2 |
| InChIKey | GBXGQCKRFPPBFW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |