C24H27BrN2OS — CID 41049021
2-[1-[(4-bromophenyl)methyl]indol-3-yl]sulfanyl-1-[(2S)-2-ethylpiperidin-1-yl]ethanone (PubChem CID 41049021) has the molecular formula C24H27BrN2OS and a molecular weight of 471.46 g/mol. Its IUPAC name is 2-[1-[(4-bromophenyl)methyl]indol-3-yl]sulfanyl-1-[(2S)-2-ethylpiperidin-1-yl]ethanone.
| Compound Name | 2-[1-[(4-bromophenyl)methyl]indol-3-yl]sulfanyl-1-[(2S)-2-ethylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 41049021 |
| Molecular Formula | C24H27BrN2OS |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 2-[1-[(4-bromophenyl)methyl]indol-3-yl]sulfanyl-1-[(2S)-2-ethylpiperidin-1-yl]ethanone |
| SMILES | CC[C@H]1CCCCN1C(=O)CSc1cn(Cc2ccc(Br)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H27BrN2OS/c1-2-20-7-5-6-14-27(20)24(28)17-29-23-16-26(22-9-4-3-8-21(22)23)15-18-10-12-19(25)13-11-18/h3-4,8-13,16,20H,2,5-7,14-15,17H2,1H3/t20-/m0/s1 |
| InChIKey | AYGCVKYBPZZRDP-FQEVSTJZSA-N |
| XLogP | 6.34 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |