C21H22N2O3S — CID 3420060
ethyl 4-[[2-(1-ethylindol-3-yl)sulfanylacetyl]amino]benzoate (PubChem CID 3420060) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is ethyl 4-[[2-(1-ethylindol-3-yl)sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(1-ethylindol-3-yl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 3420060 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | ethyl 4-[[2-(1-ethylindol-3-yl)sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2cn(CC)c3ccccc23)cc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-3-23-13-19(17-7-5-6-8-18(17)23)27-14-20(24)22-16-11-9-15(10-12-16)21(25)26-4-2/h5-13H,3-4,14H2,1-2H3,(H,22,24) |
| InChIKey | CIJKLVZDOUVFBF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |