C24H26ClN3O3 — CID 41108922
ethyl 4-[2-[1-[(4-chlorophenyl)methyl]indol-3-yl]acetyl]piperazine-1-carboxylate (PubChem CID 41108922) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is ethyl 4-[2-[1-[(4-chlorophenyl)methyl]indol-3-yl]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[1-[(4-chlorophenyl)methyl]indol-3-yl]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 41108922 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | ethyl 4-[2-[1-[(4-chlorophenyl)methyl]indol-3-yl]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)Cc2cn(Cc3ccc(Cl)cc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C24H26ClN3O3/c1-2-31-24(30)27-13-11-26(12-14-27)23(29)15-19-17-28(22-6-4-3-5-21(19)22)16-18-7-9-20(25)10-8-18/h3-10,17H,2,11-16H2,1H3 |
| InChIKey | YZIWILWAAXCOPW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |