C24H21ClN2O — CID 41108967
2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(3-methylphenyl)acetamide (PubChem CID 41108967) has the molecular formula C24H21ClN2O and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 41108967 |
| Molecular Formula | C24H21ClN2O |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cc2cn(Cc3ccc(Cl)cc3)c3ccccc23)c1 |
| InChI | InChI=1S/C24H21ClN2O/c1-17-5-4-6-21(13-17)26-24(28)14-19-16-27(23-8-3-2-7-22(19)23)15-18-9-11-20(25)12-10-18/h2-13,16H,14-15H2,1H3,(H,26,28) |
| InChIKey | ZLXDEYAITHCLIZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |