C27H21Cl2N3O — CID 21234654
(E)-2-cyano-4-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-N-(3-methylphenyl)but-2-enamide (PubChem CID 21234654) has the molecular formula C27H21Cl2N3O and a molecular weight of 474.39 g/mol. Its IUPAC name is (E)-2-cyano-4-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-N-(3-methylphenyl)but-2-enamide.
| Compound Name | (E)-2-cyano-4-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-N-(3-methylphenyl)but-2-enamide |
|---|---|
| PubChem CID | 21234654 |
| Molecular Formula | C27H21Cl2N3O |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (E)-2-cyano-4-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]-N-(3-methylphenyl)but-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C/Cc2cn(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C27H21Cl2N3O/c1-18-5-4-6-22(13-18)31-27(33)20(15-30)10-11-21-17-32(26-8-3-2-7-23(21)26)16-19-9-12-24(28)25(29)14-19/h2-10,12-14,17H,11,16H2,1H3,(H,31,33)/b20-10+ |
| InChIKey | SWJWNRJXOHREJG-KEBDBYFISA-N |
| XLogP | 6.94 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|