C23H25ClN2O — CID 12004832
1-(azepan-1-yl)-2-[1-[(3-chlorophenyl)methyl]indol-3-yl]ethanone (PubChem CID 12004832) has the molecular formula C23H25ClN2O and a molecular weight of 380.92 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[1-[(3-chlorophenyl)methyl]indol-3-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[1-[(3-chlorophenyl)methyl]indol-3-yl]ethanone |
|---|---|
| PubChem CID | 12004832 |
| Molecular Formula | C23H25ClN2O |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-(azepan-1-yl)-2-[1-[(3-chlorophenyl)methyl]indol-3-yl]ethanone |
| SMILES | O=C(Cc1cn(Cc2cccc(Cl)c2)c2ccccc12)N1CCCCCC1 |
| InChI | InChI=1S/C23H25ClN2O/c24-20-9-7-8-18(14-20)16-26-17-19(21-10-3-4-11-22(21)26)15-23(27)25-12-5-1-2-6-13-25/h3-4,7-11,14,17H,1-2,5-6,12-13,15-16H2 |
| InChIKey | CEFLYWLOGMIBCY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |