C29H38N2O3 — CID 70294628
2-[5-butoxy-1-[(3-butoxyphenyl)methyl]indol-3-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 70294628) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is 2-[5-butoxy-1-[(3-butoxyphenyl)methyl]indol-3-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[5-butoxy-1-[(3-butoxyphenyl)methyl]indol-3-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 70294628 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 2-[5-butoxy-1-[(3-butoxyphenyl)methyl]indol-3-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | CCCCOc1cccc(Cn2cc(CC(=O)N3CCCC3)c3cc(OCCCC)ccc32)c1 |
| InChI | InChI=1S/C29H38N2O3/c1-3-5-16-33-25-11-9-10-23(18-25)21-31-22-24(19-29(32)30-14-7-8-15-30)27-20-26(12-13-28(27)31)34-17-6-4-2/h9-13,18,20,22H,3-8,14-17,19,21H2,1-2H3 |
| InChIKey | HYLILFHLFVGHOW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|