C34H33NO5 — CID 122183538
2-[1-benzyl-5-[3-[3-[(4-methylphenyl)methoxy]phenoxy]propoxy]indol-3-yl]acetic acid (PubChem CID 122183538) has the molecular formula C34H33NO5 and a molecular weight of 535.64 g/mol. Its IUPAC name is 2-[1-benzyl-5-[3-[3-[(4-methylphenyl)methoxy]phenoxy]propoxy]indol-3-yl]acetic acid.
| Compound Name | 2-[1-benzyl-5-[3-[3-[(4-methylphenyl)methoxy]phenoxy]propoxy]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 122183538 |
| Molecular Formula | C34H33NO5 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 2-[1-benzyl-5-[3-[3-[(4-methylphenyl)methoxy]phenoxy]propoxy]indol-3-yl]acetic acid |
| SMILES | Cc1ccc(COc2cccc(OCCCOc3ccc4c(c3)c(CC(=O)O)cn4Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C34H33NO5/c1-25-11-13-27(14-12-25)24-40-30-10-5-9-29(20-30)38-17-6-18-39-31-15-16-33-32(21-31)28(19-34(36)37)23-35(33)22-26-7-3-2-4-8-26/h2-5,7-16,20-21,23H,6,17-19,22,24H2,1H3,(H,36,37) |
| InChIKey | QOJCHWACHRIWDR-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|