C33H31NO5 — CID 122183554
2-[1-benzyl-5-[3-[3-(4-methylphenoxy)phenoxy]propoxy]indol-3-yl]acetic acid (PubChem CID 122183554) has the molecular formula C33H31NO5 and a molecular weight of 521.61 g/mol. Its IUPAC name is 2-[1-benzyl-5-[3-[3-(4-methylphenoxy)phenoxy]propoxy]indol-3-yl]acetic acid.
| Compound Name | 2-[1-benzyl-5-[3-[3-(4-methylphenoxy)phenoxy]propoxy]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 122183554 |
| Molecular Formula | C33H31NO5 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 2-[1-benzyl-5-[3-[3-(4-methylphenoxy)phenoxy]propoxy]indol-3-yl]acetic acid |
| SMILES | Cc1ccc(Oc2cccc(OCCCOc3ccc4c(c3)c(CC(=O)O)cn4Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C33H31NO5/c1-24-11-13-27(14-12-24)39-30-10-5-9-28(20-30)37-17-6-18-38-29-15-16-32-31(21-29)26(19-33(35)36)23-34(32)22-25-7-3-2-4-8-25/h2-5,7-16,20-21,23H,6,17-19,22H2,1H3,(H,35,36) |
| InChIKey | PJXVFJUWCFLYCW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|