C32H29NO5 — CID 122183553
2-[1-benzyl-5-[3-(3-phenoxyphenoxy)propoxy]indol-3-yl]acetic acid (PubChem CID 122183553) has the molecular formula C32H29NO5 and a molecular weight of 507.59 g/mol. Its IUPAC name is 2-[1-benzyl-5-[3-(3-phenoxyphenoxy)propoxy]indol-3-yl]acetic acid.
| Compound Name | 2-[1-benzyl-5-[3-(3-phenoxyphenoxy)propoxy]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 122183553 |
| Molecular Formula | C32H29NO5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 2-[1-benzyl-5-[3-(3-phenoxyphenoxy)propoxy]indol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cn(Cc2ccccc2)c2ccc(OCCCOc3cccc(Oc4ccccc4)c3)cc12 |
| InChI | InChI=1S/C32H29NO5/c34-32(35)19-25-23-33(22-24-9-3-1-4-10-24)31-16-15-28(21-30(25)31)37-18-8-17-36-27-13-7-14-29(20-27)38-26-11-5-2-6-12-26/h1-7,9-16,20-21,23H,8,17-19,22H2,(H,34,35) |
| InChIKey | SDDVNANHJIJWDF-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|