C25H23NO3 — CID 10667803
benzyl 2-(1-benzyl-5-methoxyindol-3-yl)acetate (PubChem CID 10667803) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is benzyl 2-(1-benzyl-5-methoxyindol-3-yl)acetate.
| Compound Name | benzyl 2-(1-benzyl-5-methoxyindol-3-yl)acetate |
|---|---|
| PubChem CID | 10667803 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | benzyl 2-(1-benzyl-5-methoxyindol-3-yl)acetate |
| SMILES | COc1ccc2c(c1)c(CC(=O)OCc1ccccc1)cn2Cc1ccccc1 |
| InChI | InChI=1S/C25H23NO3/c1-28-22-12-13-24-23(15-22)21(17-26(24)16-19-8-4-2-5-9-19)14-25(27)29-18-20-10-6-3-7-11-20/h2-13,15,17H,14,16,18H2,1H3 |
| InChIKey | IIISKKWBXAHEHT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |