C26H26N2O4 — CID 70053001
4-[[3-(2-aminoethyl)-5-[(3-methoxyphenyl)methoxy]indol-1-yl]methyl]benzoic acid (PubChem CID 70053001) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 4-[[3-(2-aminoethyl)-5-[(3-methoxyphenyl)methoxy]indol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[3-(2-aminoethyl)-5-[(3-methoxyphenyl)methoxy]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 70053001 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-[[3-(2-aminoethyl)-5-[(3-methoxyphenyl)methoxy]indol-1-yl]methyl]benzoic acid |
| SMILES | COc1cccc(COc2ccc3c(c2)c(CCN)cn3Cc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-31-22-4-2-3-19(13-22)17-32-23-9-10-25-24(14-23)21(11-12-27)16-28(25)15-18-5-7-20(8-6-18)26(29)30/h2-10,13-14,16H,11-12,15,17,27H2,1H3,(H,29,30) |
| InChIKey | KWODILJRIPJTRU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |