C25H22ClFN2O3 — CID 70053116
3-[[3-(2-aminoethyl)-5-[(2-chloro-4-fluorophenyl)methoxy]indol-1-yl]methyl]benzoic acid (PubChem CID 70053116) has the molecular formula C25H22ClFN2O3 and a molecular weight of 452.91 g/mol. Its IUPAC name is 3-[[3-(2-aminoethyl)-5-[(2-chloro-4-fluorophenyl)methoxy]indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[3-(2-aminoethyl)-5-[(2-chloro-4-fluorophenyl)methoxy]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 70053116 |
| Molecular Formula | C25H22ClFN2O3 |
| Molecular Weight | 452.91 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 3-[[3-(2-aminoethyl)-5-[(2-chloro-4-fluorophenyl)methoxy]indol-1-yl]methyl]benzoic acid |
| SMILES | NCCc1cn(Cc2cccc(C(=O)O)c2)c2ccc(OCc3ccc(F)cc3Cl)cc12 |
| InChI | InChI=1S/C25H22ClFN2O3/c26-23-11-20(27)5-4-19(23)15-32-21-6-7-24-22(12-21)18(8-9-28)14-29(24)13-16-2-1-3-17(10-16)25(30)31/h1-7,10-12,14H,8-9,13,15,28H2,(H,30,31) |
| InChIKey | VOAXPGSTSURUSP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.91 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |