C24H27N3O4 — CID 70053002
1-[2-[3-(2-aminoethyl)-5-phenylmethoxyindol-1-yl]acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 70053002) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 1-[2-[3-(2-aminoethyl)-5-phenylmethoxyindol-1-yl]acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[3-(2-aminoethyl)-5-phenylmethoxyindol-1-yl]acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70053002 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 1-[2-[3-(2-aminoethyl)-5-phenylmethoxyindol-1-yl]acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCc1cn(CC(=O)N2CCCC2C(=O)O)c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C24H27N3O4/c25-11-10-18-14-26(15-23(28)27-12-4-7-22(27)24(29)30)21-9-8-19(13-20(18)21)31-16-17-5-2-1-3-6-17/h1-3,5-6,8-9,13-14,22H,4,7,10-12,15-16,25H2,(H,29,30) |
| InChIKey | YDXBUHGJAFGEDK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |