C35H27NO4 — CID 10346756
2-[4-[[3-(naphthalene-1-carbonyl)-5-phenylmethoxyindol-1-yl]methyl]phenyl]acetic acid (PubChem CID 10346756) has the molecular formula C35H27NO4 and a molecular weight of 525.60 g/mol. Its IUPAC name is 2-[4-[[3-(naphthalene-1-carbonyl)-5-phenylmethoxyindol-1-yl]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[3-(naphthalene-1-carbonyl)-5-phenylmethoxyindol-1-yl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 10346756 |
| Molecular Formula | C35H27NO4 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 2-[4-[[3-(naphthalene-1-carbonyl)-5-phenylmethoxyindol-1-yl]methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(Cn2cc(C(=O)c3cccc4ccccc34)c3cc(OCc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C35H27NO4/c37-34(38)19-24-13-15-25(16-14-24)21-36-22-32(35(39)30-12-6-10-27-9-4-5-11-29(27)30)31-20-28(17-18-33(31)36)40-23-26-7-2-1-3-8-26/h1-18,20,22H,19,21,23H2,(H,37,38) |
| InChIKey | OEXARBJNOQARFV-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |