C25H21ClN2O4 — CID 57453327
2-[(E)-[1-benzyl-5-[(3-chlorophenyl)methoxy]indol-3-yl]methylideneamino]oxyacetic acid (PubChem CID 57453327) has the molecular formula C25H21ClN2O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is 2-[(E)-[1-benzyl-5-[(3-chlorophenyl)methoxy]indol-3-yl]methylideneamino]oxyacetic acid.
| Compound Name | 2-[(E)-[1-benzyl-5-[(3-chlorophenyl)methoxy]indol-3-yl]methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 57453327 |
| Molecular Formula | C25H21ClN2O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[(E)-[1-benzyl-5-[(3-chlorophenyl)methoxy]indol-3-yl]methylideneamino]oxyacetic acid |
| SMILES | O=C(O)CO/N=C/c1cn(Cc2ccccc2)c2ccc(OCc3cccc(Cl)c3)cc12 |
| InChI | InChI=1S/C25H21ClN2O4/c26-21-8-4-7-19(11-21)16-31-22-9-10-24-23(12-22)20(13-27-32-17-25(29)30)15-28(24)14-18-5-2-1-3-6-18/h1-13,15H,14,16-17H2,(H,29,30)/b27-13+ |
| InChIKey | GXEDIEVWWCJODA-UVHMKAGCSA-N |
| XLogP | 5.36 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|