C27H20F6N2O4 — CID 76545275
2-[[1-benzyl-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]indol-3-yl]methylideneamino]oxyacetic acid (PubChem CID 76545275) has the molecular formula C27H20F6N2O4 and a molecular weight of 550.46 g/mol. Its IUPAC name is 2-[[1-benzyl-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]indol-3-yl]methylideneamino]oxyacetic acid.
| Compound Name | 2-[[1-benzyl-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]indol-3-yl]methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 76545275 |
| Molecular Formula | C27H20F6N2O4 |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 2-[[1-benzyl-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]indol-3-yl]methylideneamino]oxyacetic acid |
| SMILES | O=C(O)CON=Cc1cn(Cc2ccccc2)c2ccc(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C27H20F6N2O4/c28-26(29,30)20-8-18(9-21(10-20)27(31,32)33)15-38-22-6-7-24-23(11-22)19(12-34-39-16-25(36)37)14-35(24)13-17-4-2-1-3-5-17/h1-12,14H,13,15-16H2,(H,36,37) |
| InChIKey | UVWIAUDUHBBTTF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|