C20H19ClN2O4 — CID 57453337
2-[(E)-[5-[(2-chlorophenyl)methoxy]-1-ethylindol-3-yl]methylideneamino]oxyacetic acid (PubChem CID 57453337) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is 2-[(E)-[5-[(2-chlorophenyl)methoxy]-1-ethylindol-3-yl]methylideneamino]oxyacetic acid.
| Compound Name | 2-[(E)-[5-[(2-chlorophenyl)methoxy]-1-ethylindol-3-yl]methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 57453337 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-[(E)-[5-[(2-chlorophenyl)methoxy]-1-ethylindol-3-yl]methylideneamino]oxyacetic acid |
| SMILES | CCn1cc(/C=N/OCC(=O)O)c2cc(OCc3ccccc3Cl)ccc21 |
| InChI | InChI=1S/C20H19ClN2O4/c1-2-23-11-15(10-22-27-13-20(24)25)17-9-16(7-8-19(17)23)26-12-14-5-3-4-6-18(14)21/h3-11H,2,12-13H2,1H3,(H,24,25)/b22-10+ |
| InChIKey | VBDOYHTYJUPBFE-LSHDLFTRSA-N |
| XLogP | 4.33 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|