C29H21ClFN3O3 — CID 110167937
N-(3-chloro-4-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-phenylmethoxyindol-3-yl]-2-oxoacetamide (PubChem CID 110167937) has the molecular formula C29H21ClFN3O3 and a molecular weight of 513.96 g/mol. Its IUPAC name is N-(3-chloro-4-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-phenylmethoxyindol-3-yl]-2-oxoacetamide.
| Compound Name | N-(3-chloro-4-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-phenylmethoxyindol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 110167937 |
| Molecular Formula | C29H21ClFN3O3 |
| Molecular Weight | 513.96 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | N-(3-chloro-4-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-phenylmethoxyindol-3-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1ccncc1Cl)C(=O)c1cn(Cc2ccc(F)cc2)c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C29H21ClFN3O3/c30-25-15-32-13-12-26(25)33-29(36)28(35)24-17-34(16-19-6-8-21(31)9-7-19)27-11-10-22(14-23(24)27)37-18-20-4-2-1-3-5-20/h1-15,17H,16,18H2,(H,32,33,36) |
| InChIKey | KDIJXPSLAAGCDD-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.96 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|