C26H23FN4O4 — CID 11540127
ethyl N-[[1-[(4-fluorophenyl)methyl]-3-[2-oxo-2-(pyridin-4-ylamino)acetyl]indol-5-yl]methyl]carbamate (PubChem CID 11540127) has the molecular formula C26H23FN4O4 and a molecular weight of 474.49 g/mol. Its IUPAC name is ethyl N-[[1-[(4-fluorophenyl)methyl]-3-[2-oxo-2-(pyridin-4-ylamino)acetyl]indol-5-yl]methyl]carbamate.
| Compound Name | ethyl N-[[1-[(4-fluorophenyl)methyl]-3-[2-oxo-2-(pyridin-4-ylamino)acetyl]indol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 11540127 |
| Molecular Formula | C26H23FN4O4 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | ethyl N-[[1-[(4-fluorophenyl)methyl]-3-[2-oxo-2-(pyridin-4-ylamino)acetyl]indol-5-yl]methyl]carbamate |
| SMILES | CCOC(=O)NCc1ccc2c(c1)c(C(=O)C(=O)Nc1ccncc1)cn2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C26H23FN4O4/c1-2-35-26(34)29-14-18-5-8-23-21(13-18)22(16-31(23)15-17-3-6-19(27)7-4-17)24(32)25(33)30-20-9-11-28-12-10-20/h3-13,16H,2,14-15H2,1H3,(H,29,34)(H,28,30,33) |
| InChIKey | DZVMSHVROJVOSS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|