C22H14Cl2FN3O3 — CID 91341102
N-(3,5-dichloro-2-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-hydroxyindol-3-yl]-2-oxoacetamide (PubChem CID 91341102) has the molecular formula C22H14Cl2FN3O3 and a molecular weight of 458.28 g/mol. Its IUPAC name is N-(3,5-dichloro-2-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-hydroxyindol-3-yl]-2-oxoacetamide.
| Compound Name | N-(3,5-dichloro-2-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-hydroxyindol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 91341102 |
| Molecular Formula | C22H14Cl2FN3O3 |
| Molecular Weight | 458.28 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | N-(3,5-dichloro-2-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-hydroxyindol-3-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1ncc(Cl)cc1Cl)C(=O)c1cn(Cc2ccc(F)cc2)c2ccc(O)cc12 |
| InChI | InChI=1S/C22H14Cl2FN3O3/c23-13-7-18(24)21(26-9-13)27-22(31)20(30)17-11-28(10-12-1-3-14(25)4-2-12)19-6-5-15(29)8-16(17)19/h1-9,11,29H,10H2,(H,26,27,31) |
| InChIKey | JSSXYCLWPBPACM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.28 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|