C29H20ClFN2O3 — CID 110169325
1-(3-chloro-4-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-phenylmethoxyindol-3-yl]ethane-1,2-dione (PubChem CID 110169325) has the molecular formula C29H20ClFN2O3 and a molecular weight of 498.94 g/mol. Its IUPAC name is 1-(3-chloro-4-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-phenylmethoxyindol-3-yl]ethane-1,2-dione.
| Compound Name | 1-(3-chloro-4-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-phenylmethoxyindol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 110169325 |
| Molecular Formula | C29H20ClFN2O3 |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 1-(3-chloro-4-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-phenylmethoxyindol-3-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)c1cn(Cc2ccc(F)cc2)c2ccc(OCc3ccccc3)cc12)c1ccncc1Cl |
| InChI | InChI=1S/C29H20ClFN2O3/c30-26-15-32-13-12-23(26)28(34)29(35)25-17-33(16-19-6-8-21(31)9-7-19)27-11-10-22(14-24(25)27)36-18-20-4-2-1-3-5-20/h1-15,17H,16,18H2 |
| InChIKey | ZXYHUHXMZZAMMG-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|