C18H16FNO2 — CID 11580237
1-[1-[(4-fluorophenyl)methyl]-5-methoxyindol-3-yl]ethanone (PubChem CID 11580237) has the molecular formula C18H16FNO2 and a molecular weight of 297.33 g/mol. Its IUPAC name is 1-[1-[(4-fluorophenyl)methyl]-5-methoxyindol-3-yl]ethanone.
| Compound Name | 1-[1-[(4-fluorophenyl)methyl]-5-methoxyindol-3-yl]ethanone |
|---|---|
| PubChem CID | 11580237 |
| Molecular Formula | C18H16FNO2 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-[1-[(4-fluorophenyl)methyl]-5-methoxyindol-3-yl]ethanone |
| SMILES | COc1ccc2c(c1)c(C(C)=O)cn2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FNO2/c1-12(21)17-11-20(10-13-3-5-14(19)6-4-13)18-8-7-15(22-2)9-16(17)18/h3-9,11H,10H2,1-2H3 |
| InChIKey | FRKAJPSVFYCYEB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |