C27H26FN3O4 — CID 176898107
4-[[3-[2-[[2-(4-fluorophenyl)acetyl]amino]ethyl]-5-methoxyindol-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 176898107) has the molecular formula C27H26FN3O4 and a molecular weight of 475.52 g/mol. Its IUPAC name is 4-[[3-[2-[[2-(4-fluorophenyl)acetyl]amino]ethyl]-5-methoxyindol-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[3-[2-[[2-(4-fluorophenyl)acetyl]amino]ethyl]-5-methoxyindol-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 176898107 |
| Molecular Formula | C27H26FN3O4 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 4-[[3-[2-[[2-(4-fluorophenyl)acetyl]amino]ethyl]-5-methoxyindol-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | COc1ccc2c(c1)c(CCNC(=O)Cc1ccc(F)cc1)cn2Cc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C27H26FN3O4/c1-35-23-10-11-25-24(15-23)21(12-13-29-26(32)14-18-4-8-22(28)9-5-18)17-31(25)16-19-2-6-20(7-3-19)27(33)30-34/h2-11,15,17,34H,12-14,16H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | ZPZJHXGRZIJOSB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|