C27H25F2N3O4 — CID 176898110
4-[[3-[2-[[2-(3,4-difluorophenyl)acetyl]amino]ethyl]-5-methoxyindol-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 176898110) has the molecular formula C27H25F2N3O4 and a molecular weight of 493.51 g/mol. Its IUPAC name is 4-[[3-[2-[[2-(3,4-difluorophenyl)acetyl]amino]ethyl]-5-methoxyindol-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[3-[2-[[2-(3,4-difluorophenyl)acetyl]amino]ethyl]-5-methoxyindol-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 176898110 |
| Molecular Formula | C27H25F2N3O4 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 4-[[3-[2-[[2-(3,4-difluorophenyl)acetyl]amino]ethyl]-5-methoxyindol-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | COc1ccc2c(c1)c(CCNC(=O)Cc1ccc(F)c(F)c1)cn2Cc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C27H25F2N3O4/c1-36-21-7-9-25-22(14-21)20(10-11-30-26(33)13-18-4-8-23(28)24(29)12-18)16-32(25)15-17-2-5-19(6-3-17)27(34)31-35/h2-9,12,14,16,35H,10-11,13,15H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | IZRJAFLODQGXCX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|